Dactylifric acid

Names

Preferred IUPAC name (3R,4R,5R)-3-{[(2E)-3-(3,4-Dihydroxyphenyl)prop-2-enoyl]oxy}-4,5-dihydroxycyclohex-1-ene-1-carboxylic acid

Other names Dattelic acid; 5-O-Caffeoylshikimic acid; trans-5-O-Caffeoylshikimic acid; 5-Caffeoylshikimic acid

Identifiers

3D model (JSmol)

PubChem CID

CompTox Dashboard (EPA)

InChI InChI=1S/C16H16O8/c17-10-3-1-8(5-11(10)18)2-4-14(20)24-13-7-9(16(22)23)6-12(19)15(13)21/h1-6,12-13,15,17-19,21H,7H2,(H,22,23)/b4-2+/t12-,13-,15-/m1/s1Key: QMPHZIPNNJOWQI-GDDAOPKQSA-N

SMILES C1[C@H]([C@@H]([C@@H](C=C1C(=O)O)O)O)OC(=O)/C=C/C2=CC(=C(C=C2)O)O

Properties

Chemical formulaC16H16O8

Molar mass336.296 g·mol−1

Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Dactylifric acid (also known as dattelic acid or 5-O-caffeoylshikimic acid) is an ester derived from caffeic acid and shikimic acid. It and its isomers are enzymic browning substrates found in dates (Phoenix dactylifera fruits).

Some older sources identify dactylifric acid as 3-O-caffeoylshikimic acid.

Dactylifric acid

External links