Example functional groups of benzyl acetate: Ester group Acetyl group Benzyloxy group

In organic chemistry, a functional group is any substituent or moiety in a molecule that causes the molecule's characteristic chemical reactions. The same functional group will undergo the same or similar chemical reactions regardless of the rest of the molecule's composition. This enables systematic prediction of chemical reactions and behavior of chemical compounds and the design of chemical synthesis. The reactivity of a functional group can be modified by other functional groups nearby. Functional group interconversion can be used in retrosynthetic analysis to plan organic synthesis.

A functional group is a group of atoms in a molecule with distinctive chemical properties, regardless of the other atoms in the molecule. The atoms in a functional group are linked to each other and to the rest of the molecule by covalent bonds. For repeating units of polymers, functional groups attach to their nonpolar core of carbon atoms and thus add chemical character to carbon chains. Functional groups can also be charged, e.g. in carboxylate salts (−COO−), which turns the molecule into a polyatomic ion or a complex ion. Functional groups binding to a central atom in a coordination complex are called ligands. Complexation and solvation are also caused by specific interactions of functional groups. In the common rule of thumb "like dissolves like", it is the shared or mutually well-interacting functional groups which give rise to solubility. For example, sugar dissolves in water because both share the hydroxyl functional group (−OH) and hydroxyls interact strongly with each other. Plus, when functional groups are more electronegative than atoms they attach to, the functional groups will become polar, and the otherwise nonpolar molecules containing these functional groups become polar and so become soluble in some aqueous environment.

Combining the names of functional groups with the names of the parent alkanes generates what is termed a systematic nomenclature for naming organic compounds. In traditional nomenclature, the first carbon atom after the carbon that attaches to the functional group is called the alpha carbon; the second, beta carbon, the third, gamma carbon, etc. If there is another functional group at a carbon, it may be named with the Greek letter, e.g., the gamma-amine in gamma-aminobutyric acid is on the third carbon of the carbon chain attached to the carboxylic acid group. IUPAC conventions call for numeric labeling of the position, e.g. 4-aminobutanoic acid. In traditional names various qualifiers are used to label isomers, for example, isopropanol (IUPAC name: propan-2-ol) is an isomer of n-propanol (propan-1-ol). The term moiety has some overlap with the term "functional group". However, a moiety is an entire "half" of a molecule, which can be not only a single functional group, but also a larger unit consisting of multiple functional groups. For example, an "aryl moiety" may be any group containing an aromatic ring, regardless of how many functional groups the said aryl has.

Table of common functional groups

The following is a list of common functional groups. In the formulas, the symbols R and R' usually denote an attached hydrogen, or a hydrocarbon side chain of any length, but may sometimes refer to any group of atoms.

Hydrocarbons

Hydrocarbons are a class of molecule that is defined by functional groups called hydrocarbyls that contain only carbon and hydrogen, but vary in the number and order of double bonds. Each one differs in type (and scope) of reactivity.

Chemical classGroupFormulaStructural FormulaPrefixSuffixExample
AlkaneAlkylR(CH2)nHalkyl--aneEthane
AlkeneAlkenylR2C=CR2alkenyl--eneEthylene (Ethene)
AlkyneAlkynylRC≡CR′R − C ≡ C − R ′ {\displaystyle {\ce {R-C#C-R'}}}alkynyl--yneH − C ≡ C − H {\displaystyle {\ce {H-C#C-H}}} Acetylene (Ethyne)
Benzene derivativePhenylRC6H5 RPhphenyl-‑benzeneCumene (Isopropylbenzene)

There are also a large number of branched or ring alkanes that have specific names, e.g., tert-butyl, bornyl, cyclohexyl, etc. There are several functional groups that contain an alkene such as vinyl group, allyl group, or acrylic group. Hydrocarbons may form charged structures: positively charged carbocations or negative carbanions. Carbocations are often named -um. Examples are tropylium and triphenylmethyl cations and the cyclopentadienyl anion.

Groups containing halogens

Haloalkanes are a class of molecule that is defined by a carbon–halogen bond. This bond can be relatively weak (in the case of an iodoalkane) or quite stable (as in the case of a fluoroalkane). In general, with the exception of fluorinated compounds, haloalkanes readily undergo nucleophilic substitution reactions or elimination reactions. The substitution on the carbon, the acidity of an adjacent proton, the solvent conditions, etc. all can influence the outcome of the reactivity.

Chemical classGroupFormulaStructural formulaPrefixSuffixExample
haloalkanehaloRXR − X {\displaystyle {\ce {R-X}}}halo-alkyl halideChloroethane (Ethyl chloride)
fluoroalkanefluoroRFR − F {\displaystyle {\ce {R-F}}}fluoro-alkyl fluorideFluoromethane (Methyl fluoride)
chloroalkanechloroRClR − Cl {\displaystyle {\ce {R-Cl}}}chloro-alkyl chlorideChloromethane (Methyl chloride)
bromoalkanebromoRBrR − Br {\displaystyle {\ce {R-Br}}}bromo-alkyl bromideBromomethane (Methyl bromide)
iodoalkaneiodoRIR − I {\displaystyle {\ce {R-I}}}iodo-alkyl iodideIodomethane (Methyl iodide)

Groups containing oxygen

Compounds that contain C–O bonds each possess differing reactivity based upon the location and hybridization of the C–O bond, owing to the electron-withdrawing effect of sp²-hybridized oxygen (carbonyl groups) and the donating effects of sp³-hybridized oxygen (alcohol groups).

Chemical classGroupFormulaStructural formulaPrefixSuffixExample
AlcoholHydroxyROHHydroxylhydroxy--olMethanol
KetoneKetoneRCOR′-oyl-(-COR′) or oxo- (=O)-oneButanone (Methyl ethyl ketone)
AldehydeAldehydeRCHOformyl- (-COH) or oxo- (=O)-alAcetaldehyde (Ethanal)
Acyl halideHaloformylRCOXcarbonofluoridoyl- carbonochloridoyl- carbonobromidoyl- carbonoiodidoyl--oyl halideAcetyl chloride (Ethanoyl chloride)
CarbonateCarbonate esterROCOOR′(alkoxycarbonyl)oxy-alkyl carbonateTriphosgene (bis(trichloromethyl) carbonate)
CarboxylateCarboxylateRCOO−Carboxylatecarboxylato--oateSodium acetate (Sodium ethanoate)
Carboxylic acidCarboxylRCOOHcarboxy--oic acidAcetic acid (Ethanoic acid)
EsterCarboalkoxyRCOOR′alkanoyloxy- or alkoxycarbonylalkyl alkanoateEthyl butyrate (Ethyl butanoate)
HydroperoxideHydroperoxyROOHhydroperoxy-alkyl hydroperoxidetert-Butyl hydroperoxide
PeroxidePeroxyROOR′peroxy-alkyl peroxideDi-tert-butyl peroxide
EtherEtherROR′Etheralkoxy-alkyl etherDiethyl ether (Ethoxyethane)
HemiacetalHemiacetalR2CH(OR1)(OH)alkoxy -ol-al alkyl hemiacetal
HemiketalHemiketalRC(ORʺ)(OH)R′alkoxy -ol-one alkyl hemiketal
AcetalAcetalRCH(OR′)(OR″)dialkoxy--al dialkyl acetal
Ketal (or Acetal)Ketal (or Acetal)RC(OR″)(OR‴)R′dialkoxy--one dialkyl ketal
OrthoesterOrthoesterRC(OR′)(OR″)(OR‴)trialkoxy-
Heterocycle (if cyclic)Methylenedioxy(–OCH2O–)methylenedioxy--dioxole1,2-Methylenedioxybenzene (1,3-Benzodioxole)
Orthocarbonate esterOrthocarbonate esterC(OR)(OR′)(OR″)(OR‴)tetralkoxy-tetraalkyl orthocarbonateTetramethoxymethane
Organic acid anhydrideCarboxylic anhydrideR1(CO)O(CO)R2anhydrideButyric anhydride

Groups containing nitrogen

Compounds that contain nitrogen in this category may contain C-O bonds, such as in the case of amides.

Chemical classGroupFormulaStructural formulaPrefixSuffixExample
AmideCarboxamideRCONR'R"carboxamido- or carbamoyl--amideAcetamide (Ethanamide)
AmidineAmidineR4C(NR1)(NR2R3)amidino--amidineacetamidine (acetimidamide)
GuanidineGuanidineRNC(NR2)2Guanidin--GuanidineGuanidinopropionic acid
AminesPrimary amineRNH2amino--amineMethylamine (Methanamine)
Secondary amineR'R"NHamino--amineDimethylamine
Tertiary amineR3Namino--amineTrimethylamine
4° ammonium ionR4N+ammonio--ammoniumCholine
HydrazoneR'R"CN2H2hydrazino--hydrazineBenzophenone hydrazone
IminePrimary ketimineRC(=NH)R'imino--imine
Secondary ketimineRC(=NR")R'imino--imine
Primary aldimineRC(=NH)Himino--imineEthanimine
Secondary aldimineRC(=NR')Himino--imine
ImideImide(RCO)2NR'imido--imideSuccinimide (Pyrrolidine-2,5-dione)
AzideAzideRN3azido-alkyl azidePhenyl azide (Azidobenzene)
Azo compoundAzo (Diimide)RN2R'azo--diazeneMethyl orange (p-dimethylamino-azobenzenesulfonic acid)
CyanatesCyanateROCNcyanato-alkyl cyanateMethyl cyanate
IsocyanateRNCOisocyanato-alkyl isocyanateMethyl isocyanate
NitrateNitrateRONO2nitrooxy-, nitroxy-alkyl nitrateAmyl nitrate (1-nitrooxypentane)
NitrileNitrileRCNR − ≡ N {\displaystyle {\ce {R-\!#N}}}cyano-alkanenitrile alkyl cyanideBenzonitrile (Phenyl cyanide)
IsonitrileRNCisocyano-alkaneisonitrile alkylisocyanideH 3 C − N + ≡ C − {\displaystyle {\ce {H3C}}{-}{\overset {+}{{\ce {N}}}}{\ce {#C^-}}} Methyl isocyanide
NitriteNitrosooxyRONOnitrosooxy-alkyl nitriteIsoamyl nitrite (3-methyl-1-nitrosooxybutane)
Nitro compoundNitroRNO2nitro-Nitromethane
Nitroso compoundNitrosoRNOnitroso- (Nitrosyl-)Nitrosobenzene
OximeOximeRCH=NOHOximeAcetone oxime (2-Propanone oxime)
Pyridine derivativePyridylRC5H4N4-pyridyl (pyridin-4-yl) 3-pyridyl (pyridin-3-yl) 2-pyridyl (pyridin-2-yl)-pyridineNicotine
Carbamate esterCarbamateRO(C=O)NR2(-carbamoyl)oxy--carbamateChlorpropham (Isopropyl (3-chlorophenyl)carbamate)

Groups containing sulfur

Compounds that contain sulfur exhibit unique chemistry due to sulfur's ability to form more bonds than oxygen, its lighter analogue on the periodic table. Substitutive nomenclature (marked as prefix in table) is preferred over functional class nomenclature (marked as suffix in table) for sulfides, disulfides, sulfoxides and sulfones.

Chemical classGroupFormulaStructural formulaPrefixSuffixExample
ThiolSulfhydrylRSHsulfanyl- (-SH)-thiolEthanethiol
Sulfide (Thioether)SulfideRSR'substituentsulfanyl- (-SR')di(substituent)sulfide(Methylsulfanyl)methane(prefix)or Dimethyl sulfide (suffix)
DisulfideDisulfideRSSR'substituentdisulfanyl- (-SSR')di(substituent)disulfide(Methyldisulfanyl)methane(prefix)or Dimethyl disulfide (suffix)
SulfoxideSulfinylRSOR'-sulfinyl- (-SOR')di(substituent)sulfoxide(Methanesulfinyl)methane(prefix)or Dimethyl sulfoxide (suffix)
SulfoneSulfonylRSO2R'-sulfonyl- (-SO2R')di(substituent)sulfone(Methanesulfonyl)methane(prefix)or Dimethyl sulfone (suffix)
Sulfinic acidSulfinoRSO2Hsulfino- (-SO2H)-sulfinicacid2-Aminoethanesulfinic acid
Sulfonic acidSulfoRSO3Hsulfo- (-SO3H)-sulfonicacidBenzenesulfonic acid
Sulfonate esterSulfoRSO3R'(-sulfonyl)oxy- or alkoxysulfonyl-R' R-sulfonateMethyl trifluoromethanesulfonate or Methoxysulfonyl trifluoromethane (prefix)
ThiocyanateThiocyanateRSCNthiocyanato- (-SCN)substituentthiocyanatePhenyl thiocyanate
IsothiocyanateRNCSisothiocyanato- (-NCS)substituentisothiocyanateAllyl isothiocyanate
ThioketoneCarbonothioylRCSR'-thioyl- (-CSR') or sulfanylidene- (=S)-thioneDiphenylmethanethione (Thiobenzophenone)
ThialCarbonothioylRCSHmethanethioyl- (-CSH) or sulfanylidene- (=S)-thialThioformaldehyde (methanethial)
Thiocarboxylic acidCarbothioic S-acidRC=OSHThioic S-acidmercaptocarbonyl--thioic S-acidThiobenzoic acid (benzothioicS-acid)
Carbothioic O-acidRC=SOHThioic O-acidhydroxy(thiocarbonyl)--thioic O-acid
ThioesterThiolesterRC=OSR'S-alkyl-alkane-thioateS-Methyl thioacrylate (S-Methyl prop-2-enethioate)
ThionoesterRC=SOR'O-alkyl-alkane-thioate
Dithiocarboxylic acidCarbodithioic acidRCS2HDithiocarboxylic aciddithiocarboxy--dithioic acidDithiobenzoic acid (Benzenecarbodithioic acid)
Dithiocarboxylic acid esterCarbodithioRC=SSR'-dithioate

Groups containing phosphorus

Compounds that contain phosphorus exhibit unique chemistry due to the ability of phosphorus to form more bonds than nitrogen, its lighter analogue on the periodic table.

Chemical classGroupFormulaStructural formulaPrefixSuffixExample
Phosphine (Phosphane)PhosphinoR3Pphosphanyl--phosphaneMethylpropylphosphane
Phosphonic acidPhosphonoRP ( = O ) ( OH ) 2 {\displaystyle {\ce {RP(=O)(OH)2}}}phosphono-substituent phosphonic acidBenzylphosphonic acid
PhosphatePhosphateROP ( = O ) ( OH ) 2 {\displaystyle {\ce {ROP(=O)(OH)2}}}phosphonooxy- or O-phosphono-(phospho-)substituent phosphateGlyceraldehyde3-phosphate (suffix)
O-Phosphonocholine(prefix) (Phosphocholine)
PhosphodiesterPhosphateHOPO(OR)2[(alkoxy)hydroxyphosphoryl]oxy- or O-[(alkoxy)hydroxyphosphoryl]-di(substituent) hydrogenphosphate or phosphoricacid di(substituent)esterDNA
O‑[(2‑Guanidinoethoxy)hydroxyphosphoryl]‑l‑serine(prefix) (Lombricine)

Groups containing boron

Compounds containing boron exhibit unique chemistry due to their having partially filled octets and therefore acting as Lewis acids.

Chemical classGroupFormulaStructural formulaPrefixSuffixExample
Boronic acidBoronoRB(OH)2Borono-substituent boronic acidPhenylboronic acid
Boronic esterBoronateRB(OR)2O-[bis(alkoxy)alkylboronyl]-substituent boronic acid di(substituent) ester
Borinic acidBorinoR2BOHHydroxyborino-di(substituent) borinic acid
Borinic esterBorinateR2BORO-[alkoxydialkylboronyl]-di(substituent) borinic acid substituent esterDiphenylborinic acid 2-aminoethyl ester (2-Aminoethoxydiphenyl borate)

Groups containing metals

Chemical classStructural formulaPrefixSuffixExample
AlkyllithiumRLi(tri/di)alkyl--lithiummethyllithium
Alkylmagnesium halideRMgX (X=Cl, Br, I)[note 1]-magnesium halidemethylmagnesium chloride
AlkylaluminiumAl2R6-aluminiumtrimethylaluminium
Silyl etherR3SiOR-silyl ethertrimethylsilyl triflate

note 1 Fluorine is too electronegative to be bonded to magnesium; it becomes an ionic salt instead.

Names of radicals or moieties

These names are used to refer to the moieties themselves or to radical species, and also to form the names of halides and substituents in larger molecules.

When the parent hydrocarbon is unsaturated, the suffix ("-yl", "-ylidene", or "-ylidyne") replaces "-ane" (e.g. "ethane" becomes "ethyl"); otherwise, the suffix replaces only the final "-e" (e.g. "ethyne" becomes "ethynyl").

When used to refer to moieties, multiple single bonds differ from a single multiple bond. For example, a methylene bridge (methanediyl) has two single bonds, whereas a methylidene group (methylidene) has one double bond. Suffixes can be combined, as in methylidyne (triple bond) vs. methylylidene (single bond and double bond) vs. methanetriyl (three double bonds).

There are some retained names, such as methylene for methanediyl, 1,x-phenylene for phenyl-1,x-diyl (where x is 2, 3, or 4), carbyne for methylidyne, and trityl for triphenylmethyl.

Chemical classGroupFormulaStructural formulaPrefixSuffixExample
Single bondR•Ylo--ylMethyl group Methyl radical
Double bondR:?-ylideneMethylidene
Triple bondR⫶?-ylidyneMethylidyne
Carboxylic acyl radicalAcylR−C(=O)•?-oylAcetyl

See also

External links

  • (PDF). IUPAC. 2 April 2004. Archived from (PDF) on 27 September 2007.