Functional group
In-game article clicks load inline without leaving the challenge.

In organic chemistry, a functional group is any substituent or moiety in a molecule that causes the molecule's characteristic chemical reactions. The same functional group will undergo the same or similar chemical reactions regardless of the rest of the molecule's composition. This enables systematic prediction of chemical reactions and behavior of chemical compounds and the design of chemical synthesis. The reactivity of a functional group can be modified by other functional groups nearby. Functional group interconversion can be used in retrosynthetic analysis to plan organic synthesis.
A functional group is a group of atoms in a molecule with distinctive chemical properties, regardless of the other atoms in the molecule. The atoms in a functional group are linked to each other and to the rest of the molecule by covalent bonds. For repeating units of polymers, functional groups attach to their nonpolar core of carbon atoms and thus add chemical character to carbon chains. Functional groups can also be charged, e.g. in carboxylate salts (−COO−), which turns the molecule into a polyatomic ion or a complex ion. Functional groups binding to a central atom in a coordination complex are called ligands. Complexation and solvation are also caused by specific interactions of functional groups. In the common rule of thumb "like dissolves like", it is the shared or mutually well-interacting functional groups which give rise to solubility. For example, sugar dissolves in water because both share the hydroxyl functional group (−OH) and hydroxyls interact strongly with each other. Plus, when functional groups are more electronegative than atoms they attach to, the functional groups will become polar, and the otherwise nonpolar molecules containing these functional groups become polar and so become soluble in some aqueous environment.
Combining the names of functional groups with the names of the parent alkanes generates what is termed a systematic nomenclature for naming organic compounds. In traditional nomenclature, the first carbon atom after the carbon that attaches to the functional group is called the alpha carbon; the second, beta carbon, the third, gamma carbon, etc. If there is another functional group at a carbon, it may be named with the Greek letter, e.g., the gamma-amine in gamma-aminobutyric acid is on the third carbon of the carbon chain attached to the carboxylic acid group. IUPAC conventions call for numeric labeling of the position, e.g. 4-aminobutanoic acid. In traditional names various qualifiers are used to label isomers, for example, isopropanol (IUPAC name: propan-2-ol) is an isomer of n-propanol (propan-1-ol). The term moiety has some overlap with the term "functional group". However, a moiety is an entire "half" of a molecule, which can be not only a single functional group, but also a larger unit consisting of multiple functional groups. For example, an "aryl moiety" may be any group containing an aromatic ring, regardless of how many functional groups the said aryl has.
Table of common functional groups
The following is a list of common functional groups. In the formulas, the symbols R and R' usually denote an attached hydrogen, or a hydrocarbon side chain of any length, but may sometimes refer to any group of atoms.
Hydrocarbons
Hydrocarbons are a class of molecule that is defined by functional groups called hydrocarbyls that contain only carbon and hydrogen, but vary in the number and order of double bonds. Each one differs in type (and scope) of reactivity.
| Chemical class | Group | Formula | Structural Formula | Prefix | Suffix | Example |
|---|---|---|---|---|---|---|
| Alkane | Alkyl | R(CH2)nH | alkyl- | -ane | Ethane | |
| Alkene | Alkenyl | R2C=CR2 | alkenyl- | -ene | Ethylene (Ethene) | |
| Alkyne | Alkynyl | RC≡CR′ | R − C ≡ C − R ′ {\displaystyle {\ce {R-C#C-R'}}} | alkynyl- | -yne | H − C ≡ C − H {\displaystyle {\ce {H-C#C-H}}} Acetylene (Ethyne) |
| Benzene derivative | Phenyl | RC6H5 RPh | phenyl- | ‑benzene | Cumene (Isopropylbenzene) |
There are also a large number of branched or ring alkanes that have specific names, e.g., tert-butyl, bornyl, cyclohexyl, etc. There are several functional groups that contain an alkene such as vinyl group, allyl group, or acrylic group. Hydrocarbons may form charged structures: positively charged carbocations or negative carbanions. Carbocations are often named -um. Examples are tropylium and triphenylmethyl cations and the cyclopentadienyl anion.
Groups containing halogens
Haloalkanes are a class of molecule that is defined by a carbon–halogen bond. This bond can be relatively weak (in the case of an iodoalkane) or quite stable (as in the case of a fluoroalkane). In general, with the exception of fluorinated compounds, haloalkanes readily undergo nucleophilic substitution reactions or elimination reactions. The substitution on the carbon, the acidity of an adjacent proton, the solvent conditions, etc. all can influence the outcome of the reactivity.
| Chemical class | Group | Formula | Structural formula | Prefix | Suffix | Example |
|---|---|---|---|---|---|---|
| haloalkane | halo | RX | R − X {\displaystyle {\ce {R-X}}} | halo- | alkyl halide | Chloroethane (Ethyl chloride) |
| fluoroalkane | fluoro | RF | R − F {\displaystyle {\ce {R-F}}} | fluoro- | alkyl fluoride | Fluoromethane (Methyl fluoride) |
| chloroalkane | chloro | RCl | R − Cl {\displaystyle {\ce {R-Cl}}} | chloro- | alkyl chloride | Chloromethane (Methyl chloride) |
| bromoalkane | bromo | RBr | R − Br {\displaystyle {\ce {R-Br}}} | bromo- | alkyl bromide | Bromomethane (Methyl bromide) |
| iodoalkane | iodo | RI | R − I {\displaystyle {\ce {R-I}}} | iodo- | alkyl iodide | Iodomethane (Methyl iodide) |
Groups containing oxygen
Compounds that contain C–O bonds each possess differing reactivity based upon the location and hybridization of the C–O bond, owing to the electron-withdrawing effect of sp²-hybridized oxygen (carbonyl groups) and the donating effects of sp³-hybridized oxygen (alcohol groups).
| Chemical class | Group | Formula | Structural formula | Prefix | Suffix | Example |
|---|---|---|---|---|---|---|
| Alcohol | Hydroxy | ROH | Hydroxyl | hydroxy- | -ol | Methanol |
| Ketone | Ketone | RCOR′ | -oyl-(-COR′) or oxo- (=O) | -one | Butanone (Methyl ethyl ketone) | |
| Aldehyde | Aldehyde | RCHO | formyl- (-COH) or oxo- (=O) | -al | Acetaldehyde (Ethanal) | |
| Acyl halide | Haloformyl | RCOX | carbonofluoridoyl- carbonochloridoyl- carbonobromidoyl- carbonoiodidoyl- | -oyl halide | Acetyl chloride (Ethanoyl chloride) | |
| Carbonate | Carbonate ester | ROCOOR′ | (alkoxycarbonyl)oxy- | alkyl carbonate | Triphosgene (bis(trichloromethyl) carbonate) | |
| Carboxylate | Carboxylate | RCOO− | Carboxylate | carboxylato- | -oate | Sodium acetate (Sodium ethanoate) |
| Carboxylic acid | Carboxyl | RCOOH | carboxy- | -oic acid | Acetic acid (Ethanoic acid) | |
| Ester | Carboalkoxy | RCOOR′ | alkanoyloxy- or alkoxycarbonyl | alkyl alkanoate | Ethyl butyrate (Ethyl butanoate) | |
| Hydroperoxide | Hydroperoxy | ROOH | hydroperoxy- | alkyl hydroperoxide | tert-Butyl hydroperoxide | |
| Peroxide | Peroxy | ROOR′ | peroxy- | alkyl peroxide | Di-tert-butyl peroxide | |
| Ether | Ether | ROR′ | Ether | alkoxy- | alkyl ether | Diethyl ether (Ethoxyethane) |
| Hemiacetal | Hemiacetal | R2CH(OR1)(OH) | alkoxy -ol | -al alkyl hemiacetal | ||
| Hemiketal | Hemiketal | RC(ORʺ)(OH)R′ | alkoxy -ol | -one alkyl hemiketal | ||
| Acetal | Acetal | RCH(OR′)(OR″) | dialkoxy- | -al dialkyl acetal | ||
| Ketal (or Acetal) | Ketal (or Acetal) | RC(OR″)(OR‴)R′ | dialkoxy- | -one dialkyl ketal | ||
| Orthoester | Orthoester | RC(OR′)(OR″)(OR‴) | trialkoxy- | |||
| Heterocycle (if cyclic) | Methylenedioxy | (–OCH2O–) | methylenedioxy- | -dioxole | 1,2-Methylenedioxybenzene (1,3-Benzodioxole) | |
| Orthocarbonate ester | Orthocarbonate ester | C(OR)(OR′)(OR″)(OR‴) | tetralkoxy- | tetraalkyl orthocarbonate | Tetramethoxymethane | |
| Organic acid anhydride | Carboxylic anhydride | R1(CO)O(CO)R2 | anhydride | Butyric anhydride |
Groups containing nitrogen
Compounds that contain nitrogen in this category may contain C-O bonds, such as in the case of amides.
| Chemical class | Group | Formula | Structural formula | Prefix | Suffix | Example |
|---|---|---|---|---|---|---|
| Amide | Carboxamide | RCONR'R" | carboxamido- or carbamoyl- | -amide | Acetamide (Ethanamide) | |
| Amidine | Amidine | R4C(NR1)(NR2R3) | amidino- | -amidine | acetamidine (acetimidamide) | |
| Guanidine | Guanidine | RNC(NR2)2 | Guanidin- | -Guanidine | Guanidinopropionic acid | |
| Amines | Primary amine | RNH2 | amino- | -amine | Methylamine (Methanamine) | |
| Secondary amine | R'R"NH | amino- | -amine | Dimethylamine | ||
| Tertiary amine | R3N | amino- | -amine | Trimethylamine | ||
| 4° ammonium ion | R4N+ | ammonio- | -ammonium | Choline | ||
| Hydrazone | R'R"CN2H2 | hydrazino- | -hydrazine | Benzophenone hydrazone | ||
| Imine | Primary ketimine | RC(=NH)R' | imino- | -imine | ||
| Secondary ketimine | RC(=NR")R' | imino- | -imine | |||
| Primary aldimine | RC(=NH)H | imino- | -imine | Ethanimine | ||
| Secondary aldimine | RC(=NR')H | imino- | -imine | |||
| Imide | Imide | (RCO)2NR' | imido- | -imide | Succinimide (Pyrrolidine-2,5-dione) | |
| Azide | Azide | RN3 | azido- | alkyl azide | Phenyl azide (Azidobenzene) | |
| Azo compound | Azo (Diimide) | RN2R' | azo- | -diazene | Methyl orange (p-dimethylamino-azobenzenesulfonic acid) | |
| Cyanates | Cyanate | ROCN | cyanato- | alkyl cyanate | Methyl cyanate | |
| Isocyanate | RNCO | isocyanato- | alkyl isocyanate | Methyl isocyanate | ||
| Nitrate | Nitrate | RONO2 | nitrooxy-, nitroxy- | alkyl nitrate | Amyl nitrate (1-nitrooxypentane) | |
| Nitrile | Nitrile | RCN | R − ≡ N {\displaystyle {\ce {R-\!#N}}} | cyano- | alkanenitrile alkyl cyanide | Benzonitrile (Phenyl cyanide) |
| Isonitrile | RNC | isocyano- | alkaneisonitrile alkylisocyanide | H 3 C − N + ≡ C − {\displaystyle {\ce {H3C}}{-}{\overset {+}{{\ce {N}}}}{\ce {#C^-}}} Methyl isocyanide | ||
| Nitrite | Nitrosooxy | RONO | nitrosooxy- | alkyl nitrite | Isoamyl nitrite (3-methyl-1-nitrosooxybutane) | |
| Nitro compound | Nitro | RNO2 | nitro- | Nitromethane | ||
| Nitroso compound | Nitroso | RNO | nitroso- (Nitrosyl-) | Nitrosobenzene | ||
| Oxime | Oxime | RCH=NOH | Oxime | Acetone oxime (2-Propanone oxime) | ||
| Pyridine derivative | Pyridyl | RC5H4N | 4-pyridyl (pyridin-4-yl) 3-pyridyl (pyridin-3-yl) 2-pyridyl (pyridin-2-yl) | -pyridine | Nicotine | |
| Carbamate ester | Carbamate | RO(C=O)NR2 | (-carbamoyl)oxy- | -carbamate | Chlorpropham (Isopropyl (3-chlorophenyl)carbamate) |
Groups containing sulfur
Compounds that contain sulfur exhibit unique chemistry due to sulfur's ability to form more bonds than oxygen, its lighter analogue on the periodic table. Substitutive nomenclature (marked as prefix in table) is preferred over functional class nomenclature (marked as suffix in table) for sulfides, disulfides, sulfoxides and sulfones.
| Chemical class | Group | Formula | Structural formula | Prefix | Suffix | Example |
|---|---|---|---|---|---|---|
| Thiol | Sulfhydryl | RSH | sulfanyl- (-SH) | -thiol | Ethanethiol | |
| Sulfide (Thioether) | Sulfide | RSR' | substituentsulfanyl- (-SR') | di(substituent)sulfide | (Methylsulfanyl)methane(prefix)or Dimethyl sulfide (suffix) | |
| Disulfide | Disulfide | RSSR' | substituentdisulfanyl- (-SSR') | di(substituent)disulfide | (Methyldisulfanyl)methane(prefix)or Dimethyl disulfide (suffix) | |
| Sulfoxide | Sulfinyl | RSOR' | -sulfinyl- (-SOR') | di(substituent)sulfoxide | (Methanesulfinyl)methane(prefix)or Dimethyl sulfoxide (suffix) | |
| Sulfone | Sulfonyl | RSO2R' | -sulfonyl- (-SO2R') | di(substituent)sulfone | (Methanesulfonyl)methane(prefix)or Dimethyl sulfone (suffix) | |
| Sulfinic acid | Sulfino | RSO2H | sulfino- (-SO2H) | -sulfinicacid | 2-Aminoethanesulfinic acid | |
| Sulfonic acid | Sulfo | RSO3H | sulfo- (-SO3H) | -sulfonicacid | Benzenesulfonic acid | |
| Sulfonate ester | Sulfo | RSO3R' | (-sulfonyl)oxy- or alkoxysulfonyl- | R' R-sulfonate | Methyl trifluoromethanesulfonate or Methoxysulfonyl trifluoromethane (prefix) | |
| Thiocyanate | Thiocyanate | RSCN | thiocyanato- (-SCN) | substituentthiocyanate | Phenyl thiocyanate | |
| Isothiocyanate | RNCS | isothiocyanato- (-NCS) | substituentisothiocyanate | Allyl isothiocyanate | ||
| Thioketone | Carbonothioyl | RCSR' | -thioyl- (-CSR') or sulfanylidene- (=S) | -thione | Diphenylmethanethione (Thiobenzophenone) | |
| Thial | Carbonothioyl | RCSH | methanethioyl- (-CSH) or sulfanylidene- (=S) | -thial | Thioformaldehyde (methanethial) | |
| Thiocarboxylic acid | Carbothioic S-acid | RC=OSH | Thioic S-acid | mercaptocarbonyl- | -thioic S-acid | Thiobenzoic acid (benzothioicS-acid) |
| Carbothioic O-acid | RC=SOH | Thioic O-acid | hydroxy(thiocarbonyl)- | -thioic O-acid | ||
| Thioester | Thiolester | RC=OSR' | S-alkyl-alkane-thioate | S-Methyl thioacrylate (S-Methyl prop-2-enethioate) | ||
| Thionoester | RC=SOR' | O-alkyl-alkane-thioate | ||||
| Dithiocarboxylic acid | Carbodithioic acid | RCS2H | Dithiocarboxylic acid | dithiocarboxy- | -dithioic acid | Dithiobenzoic acid (Benzenecarbodithioic acid) |
| Dithiocarboxylic acid ester | Carbodithio | RC=SSR' | -dithioate |
Groups containing phosphorus
Compounds that contain phosphorus exhibit unique chemistry due to the ability of phosphorus to form more bonds than nitrogen, its lighter analogue on the periodic table.
| Chemical class | Group | Formula | Structural formula | Prefix | Suffix | Example |
|---|---|---|---|---|---|---|
| Phosphine (Phosphane) | Phosphino | R3P | phosphanyl- | -phosphane | Methylpropylphosphane | |
| Phosphonic acid | Phosphono | RP ( = O ) ( OH ) 2 {\displaystyle {\ce {RP(=O)(OH)2}}} | phosphono- | substituent phosphonic acid | Benzylphosphonic acid | |
| Phosphate | Phosphate | ROP ( = O ) ( OH ) 2 {\displaystyle {\ce {ROP(=O)(OH)2}}} | phosphonooxy- or O-phosphono-(phospho-) | substituent phosphate | Glyceraldehyde3-phosphate (suffix) | |
| O-Phosphonocholine(prefix) (Phosphocholine) | ||||||
| Phosphodiester | Phosphate | HOPO(OR)2 | [(alkoxy)hydroxyphosphoryl]oxy- or O-[(alkoxy)hydroxyphosphoryl]- | di(substituent) hydrogenphosphate or phosphoricacid di(substituent)ester | DNA | |
| O‑[(2‑Guanidinoethoxy)hydroxyphosphoryl]‑l‑serine(prefix) (Lombricine) |
Groups containing boron
Compounds containing boron exhibit unique chemistry due to their having partially filled octets and therefore acting as Lewis acids.
| Chemical class | Group | Formula | Structural formula | Prefix | Suffix | Example |
|---|---|---|---|---|---|---|
| Boronic acid | Borono | RB(OH)2 | Borono- | substituent boronic acid | Phenylboronic acid | |
| Boronic ester | Boronate | RB(OR)2 | O-[bis(alkoxy)alkylboronyl]- | substituent boronic acid di(substituent) ester | ||
| Borinic acid | Borino | R2BOH | Hydroxyborino- | di(substituent) borinic acid | ||
| Borinic ester | Borinate | R2BOR | O-[alkoxydialkylboronyl]- | di(substituent) borinic acid substituent ester | Diphenylborinic acid 2-aminoethyl ester (2-Aminoethoxydiphenyl borate) |
Groups containing metals
| Chemical class | Structural formula | Prefix | Suffix | Example |
|---|---|---|---|---|
| Alkyllithium | RLi | (tri/di)alkyl- | -lithium | methyllithium |
| Alkylmagnesium halide | RMgX (X=Cl, Br, I)[note 1] | -magnesium halide | methylmagnesium chloride | |
| Alkylaluminium | Al2R6 | -aluminium | trimethylaluminium | |
| Silyl ether | R3SiOR | -silyl ether | trimethylsilyl triflate |
note 1 Fluorine is too electronegative to be bonded to magnesium; it becomes an ionic salt instead.
Names of radicals or moieties
These names are used to refer to the moieties themselves or to radical species, and also to form the names of halides and substituents in larger molecules.
When the parent hydrocarbon is unsaturated, the suffix ("-yl", "-ylidene", or "-ylidyne") replaces "-ane" (e.g. "ethane" becomes "ethyl"); otherwise, the suffix replaces only the final "-e" (e.g. "ethyne" becomes "ethynyl").
When used to refer to moieties, multiple single bonds differ from a single multiple bond. For example, a methylene bridge (methanediyl) has two single bonds, whereas a methylidene group (methylidene) has one double bond. Suffixes can be combined, as in methylidyne (triple bond) vs. methylylidene (single bond and double bond) vs. methanetriyl (three double bonds).
There are some retained names, such as methylene for methanediyl, 1,x-phenylene for phenyl-1,x-diyl (where x is 2, 3, or 4), carbyne for methylidyne, and trityl for triphenylmethyl.
| Chemical class | Group | Formula | Structural formula | Prefix | Suffix | Example |
|---|---|---|---|---|---|---|
| Single bond | R• | Ylo- | -yl | Methyl group Methyl radical | ||
| Double bond | R: | ? | -ylidene | Methylidene | ||
| Triple bond | R⫶ | ? | -ylidyne | Methylidyne | ||
| Carboxylic acyl radical | Acyl | R−C(=O)• | ? | -oyl | Acetyl |
See also
- Category:Functional groups
- Group contribution method
External links
- (PDF). IUPAC. 2 April 2004. Archived from (PDF) on 27 September 2007.